C25H27Cl2N3O6 — CID 2951062
methyl 4-[[2-(3,4-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 2951062) has the molecular formula C25H27Cl2N3O6 and a molecular weight of 536.41 g/mol. Its IUPAC name is methyl 4-[[2-(3,4-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[[2-(3,4-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 2951062 |
| Molecular Formula | C25H27Cl2N3O6 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | methyl 4-[[2-(3,4-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c(C)c(C(O)=C2C(=O)C(=O)N(CCN3CCOCC3)C2c2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C25H27Cl2N3O6/c1-13-18(14(2)28-20(13)25(34)35-3)22(31)19-21(15-4-5-16(26)17(27)12-15)30(24(33)23(19)32)7-6-29-8-10-36-11-9-29/h4-5,12,21,28,31H,6-11H2,1-3H3 |
| InChIKey | GXWGLDSTPQSEMO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|