C28H33N3O8 — CID 98316187
methyl 4-[(E)-hydroxy-[(2S)-2-(4-methoxycarbonylphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 98316187) has the molecular formula C28H33N3O8 and a molecular weight of 539.59 g/mol. Its IUPAC name is methyl 4-[(E)-hydroxy-[(2S)-2-(4-methoxycarbonylphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(E)-hydroxy-[(2S)-2-(4-methoxycarbonylphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 98316187 |
| Molecular Formula | C28H33N3O8 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | methyl 4-[(E)-hydroxy-[(2S)-2-(4-methoxycarbonylphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc([C@H]2/C(=C(\O)c3c(C)[nH]c(C(=O)OC)c3C)C(=O)C(=O)N2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C28H33N3O8/c1-16-20(17(2)29-22(16)28(36)38-4)24(32)21-23(18-6-8-19(9-7-18)27(35)37-3)31(26(34)25(21)33)11-5-10-30-12-14-39-15-13-30/h6-9,23,29,32H,5,10-15H2,1-4H3/b24-21+/t23-/m0/s1 |
| InChIKey | MPSYLGVZAKYBHO-BUANBSPESA-N |
| XLogP | 2.35 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|