C28H35N3O7 — CID 41030843
methyl 4-[(E)-[(2R)-2-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 41030843) has the molecular formula C28H35N3O7 and a molecular weight of 525.60 g/mol. Its IUPAC name is methyl 4-[(E)-[(2R)-2-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(E)-[(2R)-2-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 41030843 |
| Molecular Formula | C28H35N3O7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | methyl 4-[(E)-[(2R)-2-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOc1ccc([C@@H]2/C(=C(\O)c3c(C)[nH]c(C(=O)OC)c3C)C(=O)C(=O)N2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C28H35N3O7/c1-5-38-20-9-7-19(8-10-20)24-22(25(32)21-17(2)23(28(35)36-4)29-18(21)3)26(33)27(34)31(24)12-6-11-30-13-15-37-16-14-30/h7-10,24,29,32H,5-6,11-16H2,1-4H3/b25-22+/t24-/m1/s1 |
| InChIKey | DAXZTUWCOFFTRA-ZZIWUOEGSA-N |
| XLogP | 2.96 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|