C19H19ClN2O3 — CID 2955383
1-[5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-2-(2-methylphenoxy)ethanone (PubChem CID 2955383) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-2-(2-methylphenoxy)ethanone.
| Compound Name | 1-[5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-2-(2-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 2955383 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-2-(2-methylphenoxy)ethanone |
| SMILES | CC1=NN(C(=O)COc2ccccc2C)C(O)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H19ClN2O3/c1-13-5-3-4-6-17(13)25-12-18(23)22-19(24,11-14(2)21-22)15-7-9-16(20)10-8-15/h3-10,24H,11-12H2,1-2H3 |
| InChIKey | JHRIDJLESBMVJE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |