C20H21ClN2O2 — CID 1005103
1-[(5R)-5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-4-phenylbutan-1-one (PubChem CID 1005103) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 1-[(5R)-5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[(5R)-5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 1005103 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(5R)-5-(4-chlorophenyl)-5-hydroxy-3-methyl-4H-pyrazol-1-yl]-4-phenylbutan-1-one |
| SMILES | CC1=NN(C(=O)CCCc2ccccc2)[C@](O)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-15-14-20(25,17-10-12-18(21)13-11-17)23(22-15)19(24)9-5-8-16-6-3-2-4-7-16/h2-4,6-7,10-13,25H,5,8-9,14H2,1H3/t20-/m1/s1 |
| InChIKey | YGXWLCIUKZMFOZ-HXUWFJFHSA-N |
| XLogP | 4.12 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |