C20H18ClF3N2O2 — CID 3113599
1-[5-(4-chlorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one (PubChem CID 3113599) has the molecular formula C20H18ClF3N2O2 and a molecular weight of 410.82 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[5-(4-chlorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 3113599 |
| Molecular Formula | C20H18ClF3N2O2 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1N=C(C(F)(F)F)CC1(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClF3N2O2/c21-16-11-9-15(10-12-16)19(28)13-17(20(22,23)24)25-26(19)18(27)8-4-7-14-5-2-1-3-6-14/h1-3,5-6,9-12,28H,4,7-8,13H2 |
| InChIKey | KPMIBWVQJRFUJA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |