C19H12ClF7N2O2 — CID 3793306
(4-chlorophenyl)-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]methanone (PubChem CID 3793306) has the molecular formula C19H12ClF7N2O2 and a molecular weight of 468.76 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 3793306 |
| Molecular Formula | C19H12ClF7N2O2 |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | (4-chlorophenyl)-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-5-phenyl-4H-pyrazol-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1N=C(C(F)(F)C(F)(F)C(F)(F)F)CC1(O)c1ccccc1 |
| InChI | InChI=1S/C19H12ClF7N2O2/c20-13-8-6-11(7-9-13)15(30)29-16(31,12-4-2-1-3-5-12)10-14(28-29)17(21,22)18(23,24)19(25,26)27/h1-9,31H,10H2 |
| InChIKey | FPOOROBCRGIAIH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|