C16H11F4N3O2 — CID 4009638
[5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-2-ylmethanone (PubChem CID 4009638) has the molecular formula C16H11F4N3O2 and a molecular weight of 353.28 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 4009638 |
| Molecular Formula | C16H11F4N3O2 |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [5-(4-fluorophenyl)-5-hydroxy-3-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1N=C(C(F)(F)F)CC1(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11F4N3O2/c17-11-6-4-10(5-7-11)15(25)9-13(16(18,19)20)22-23(15)14(24)12-3-1-2-8-21-12/h1-8,25H,9H2 |
| InChIKey | ITKGHWFJHVXKSI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |