C28H29N3O6S — CID 2957094
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 2957094) has the molecular formula C28H29N3O6S and a molecular weight of 535.62 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 2957094 |
| Molecular Formula | C28H29N3O6S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C28H29N3O6S/c1-4-30(5-2)38(35,36)20-15-16-25(37-3)23(18-20)29-26(32)24(17-19-11-7-6-8-12-19)31-27(33)21-13-9-10-14-22(21)28(31)34/h6-16,18,24H,4-5,17H2,1-3H3,(H,29,32) |
| InChIKey | BFIDPAFMVVKSJG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|