C16H12ClN3O3S — CID 2960657
methyl 4-(2-chlorophenyl)-5-cyano-6-(cyanomethylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 2960657) has the molecular formula C16H12ClN3O3S and a molecular weight of 361.81 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-5-cyano-6-(cyanomethylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-5-cyano-6-(cyanomethylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2960657 |
| Molecular Formula | C16H12ClN3O3S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-5-cyano-6-(cyanomethylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)NC(SCC#N)=C(C#N)C1c1ccccc1Cl |
| InChI | InChI=1S/C16H12ClN3O3S/c1-23-16(22)13-12(9-4-2-3-5-11(9)17)10(8-19)15(20-14(13)21)24-7-6-18/h2-5,12-13H,7H2,1H3,(H,20,21) |
| InChIKey | ZNVJXTUBJWBTGU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|