C25H24N2O6S — CID 2960892
(4-benzylsulfonylphenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate (PubChem CID 2960892) has the molecular formula C25H24N2O6S and a molecular weight of 480.54 g/mol. Its IUPAC name is (4-benzylsulfonylphenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate.
| Compound Name | (4-benzylsulfonylphenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate |
|---|---|
| PubChem CID | 2960892 |
| Molecular Formula | C25H24N2O6S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | (4-benzylsulfonylphenyl)methyl 2-[(2-benzamidoacetyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccccc1)NCC(=O)OCc1ccc(S(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O6S/c28-23(15-27-25(30)21-9-5-2-6-10-21)26-16-24(29)33-17-19-11-13-22(14-12-19)34(31,32)18-20-7-3-1-4-8-20/h1-14H,15-18H2,(H,26,28)(H,27,30) |
| InChIKey | QUSNXDZQXCRWMA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |