C19H14N6OS — CID 2963029
5-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-2,1,3-benzoxadiazole (PubChem CID 2963029) has the molecular formula C19H14N6OS and a molecular weight of 374.43 g/mol. Its IUPAC name is 5-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-2,1,3-benzoxadiazole.
| Compound Name | 5-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 2963029 |
| Molecular Formula | C19H14N6OS |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanylmethyl]-2,1,3-benzoxadiazole |
| SMILES | C=CCn1c2ccccc2c2nnc(SCc3ccc4nonc4c3)nc21 |
| InChI | InChI=1S/C19H14N6OS/c1-2-9-25-16-6-4-3-5-13(16)17-18(25)20-19(22-21-17)27-11-12-7-8-14-15(10-12)24-26-23-14/h2-8,10H,1,9,11H2 |
| InChIKey | CBDVEMJKSUSVCA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|