C16H17N3O3S — CID 2963518
N-(3-pyrrolidin-1-ylsulfonylphenyl)pyridine-4-carboxamide (PubChem CID 2963518) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylsulfonylphenyl)pyridine-4-carboxamide.
| Compound Name | N-(3-pyrrolidin-1-ylsulfonylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2963518 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(3-pyrrolidin-1-ylsulfonylphenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCC2)c1)c1ccncc1 |
| InChI | InChI=1S/C16H17N3O3S/c20-16(13-6-8-17-9-7-13)18-14-4-3-5-15(12-14)23(21,22)19-10-1-2-11-19/h3-9,12H,1-2,10-11H2,(H,18,20) |
| InChIKey | BPAGNNPVWBZCKT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |