C19H20N4OS — CID 2963604
2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 2963604) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 2963604 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[5-(oxan-2-ylmethylsulfanyl)-4-phenyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | c1ccc(-n2c(SCC3CCCCO3)nnc2-c2ccccn2)cc1 |
| InChI | InChI=1S/C19H20N4OS/c1-2-8-15(9-3-1)23-18(17-11-4-6-12-20-17)21-22-19(23)25-14-16-10-5-7-13-24-16/h1-4,6,8-9,11-12,16H,5,7,10,13-14H2 |
| InChIKey | PTPBCVWZYPSTSZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |