C18H19N3OS2 — CID 3000170
3-(oxan-2-ylmethylsulfanyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 3000170) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-(oxan-2-ylmethylsulfanyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 3-(oxan-2-ylmethylsulfanyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 3000170 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-(oxan-2-ylmethylsulfanyl)-4-phenyl-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | c1ccc(-n2c(SCC3CCCCO3)nnc2-c2cccs2)cc1 |
| InChI | InChI=1S/C18H19N3OS2/c1-2-7-14(8-3-1)21-17(16-10-6-12-23-16)19-20-18(21)24-13-15-9-4-5-11-22-15/h1-3,6-8,10,12,15H,4-5,9,11,13H2 |
| InChIKey | DJHXACZRQFJGFU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |