C25H30N4O4S — CID 2964982
N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 2964982) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2964982 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[1-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | C=CCn1c(SCCOc2ccc(OC)cc2)nnc1C(C)NC(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30N4O4S/c1-5-14-29-24(18(2)26-23(30)17-19-6-8-20(31-3)9-7-19)27-28-25(29)34-16-15-33-22-12-10-21(32-4)11-13-22/h5-13,18H,1,14-17H2,2-4H3,(H,26,30) |
| InChIKey | DHJFVJMVUKDWLC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|