C25H28N6O5S — CID 27105051
2-(4-methoxyphenyl)-N-[(1R)-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]acetamide (PubChem CID 27105051) has the molecular formula C25H28N6O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(1R)-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[(1R)-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 27105051 |
| Molecular Formula | C25H28N6O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(1R)-1-[5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2C)nnc1[C@@H](C)NC(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H28N6O5S/c1-5-12-30-24(17(3)26-22(32)13-18-7-10-20(36-4)11-8-18)28-29-25(30)37-15-23(33)27-21-14-19(31(34)35)9-6-16(21)2/h5-11,14,17H,1,12-13,15H2,2-4H3,(H,26,32)(H,27,33)/t17-/m1/s1 |
| InChIKey | DEQJUPOOQIWHEL-QGZVFWFLSA-N |
| XLogP | 3.84 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|