C24H29N5O5S — CID 43884120
2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 43884120) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is 2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 43884120 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | COc1ccc(OC(C)c2nnc(SCC(=O)Nc3cc([N+](=O)[O-])ccc3C)n2CC(C)C)cc1 |
| InChI | InChI=1S/C24H29N5O5S/c1-15(2)13-28-23(17(4)34-20-10-8-19(33-5)9-11-20)26-27-24(28)35-14-22(30)25-21-12-18(29(31)32)7-6-16(21)3/h6-12,15,17H,13-14H2,1-5H3,(H,25,30) |
| InChIKey | KUAGWVBCGJTACT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|