C19H17F3N4O5S — CID 2965065
N-[4-[[1-(4-methylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide (PubChem CID 2965065) has the molecular formula C19H17F3N4O5S and a molecular weight of 470.43 g/mol. Its IUPAC name is N-[4-[[1-(4-methylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[1-(4-methylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2965065 |
| Molecular Formula | C19H17F3N4O5S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | N-[4-[[1-(4-methylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2(C(F)(F)F)NC(=O)N(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H17F3N4O5S/c1-11-3-7-14(8-4-11)26-16(28)18(19(20,21)22,24-17(26)29)25-32(30,31)15-9-5-13(6-10-15)23-12(2)27/h3-10,25H,1-2H3,(H,23,27)(H,24,29) |
| InChIKey | QSGFTHFJPUFUIE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|