C16H13ClN2O4S — CID 2966405
2-[3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetamide (PubChem CID 2966405) has the molecular formula C16H13ClN2O4S and a molecular weight of 364.81 g/mol. Its IUPAC name is 2-[3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetamide.
| Compound Name | 2-[3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 2966405 |
| Molecular Formula | C16H13ClN2O4S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-[3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)C(O)(CC(=O)c2ccc(Cl)s2)c2ccccc21 |
| InChI | InChI=1S/C16H13ClN2O4S/c17-13-6-5-12(24-13)11(20)7-16(23)9-3-1-2-4-10(9)19(15(16)22)8-14(18)21/h1-6,23H,7-8H2,(H2,18,21) |
| InChIKey | KWOPLGWNZGLDFH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |