C20H14ClNO3S — CID 54584569
1-[(4-chlorophenyl)methyl]-3-hydroxy-3-(thiophene-2-carbonyl)indol-2-one (PubChem CID 54584569) has the molecular formula C20H14ClNO3S and a molecular weight of 383.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-hydroxy-3-(thiophene-2-carbonyl)indol-2-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-hydroxy-3-(thiophene-2-carbonyl)indol-2-one |
|---|---|
| PubChem CID | 54584569 |
| Molecular Formula | C20H14ClNO3S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-hydroxy-3-(thiophene-2-carbonyl)indol-2-one |
| SMILES | O=C(c1cccs1)C1(O)C(=O)N(Cc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H14ClNO3S/c21-14-9-7-13(8-10-14)12-22-16-5-2-1-4-15(16)20(25,19(22)24)18(23)17-6-3-11-26-17/h1-11,25H,12H2 |
| InChIKey | MAWNHFCDCYPWDV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|