C21H21ClN6O5S — CID 2966795
2-chloro-N-[2-hydroxy-1-[4-methyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 2966795) has the molecular formula C21H21ClN6O5S and a molecular weight of 504.96 g/mol. Its IUPAC name is 2-chloro-N-[2-hydroxy-1-[4-methyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-hydroxy-1-[4-methyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 2966795 |
| Molecular Formula | C21H21ClN6O5S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-chloro-N-[2-hydroxy-1-[4-methyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CSc1nnc(C(CO)NC(=O)c2ccccc2Cl)n1C |
| InChI | InChI=1S/C21H21ClN6O5S/c1-12-7-8-13(28(32)33)9-16(12)23-18(30)11-34-21-26-25-19(27(21)2)17(10-29)24-20(31)14-5-3-4-6-15(14)22/h3-9,17,29H,10-11H2,1-2H3,(H,23,30)(H,24,31) |
| InChIKey | JSOAWQNZRFCOHJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 152.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|