C22H20N4O4 — CID 2968008
4-ethyl-13,14-dimethoxy-8-phenyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione (PubChem CID 2968008) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-ethyl-13,14-dimethoxy-8-phenyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione.
| Compound Name | 4-ethyl-13,14-dimethoxy-8-phenyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione |
|---|---|
| PubChem CID | 2968008 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-ethyl-13,14-dimethoxy-8-phenyl-1,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-2,5,10(15),11,13-pentaene-7,16-dione |
| SMILES | CCn1cc2c(n1)C(=O)N(c1ccccc1)C1c3ccc(OC)c(OC)c3C(=O)N21 |
| InChI | InChI=1S/C22H20N4O4/c1-4-24-12-15-18(23-24)22(28)25(13-8-6-5-7-9-13)20-14-10-11-16(29-2)19(30-3)17(14)21(27)26(15)20/h5-12,20H,4H2,1-3H3 |
| InChIKey | KTCNUNQUQPOYNJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |