C16H12F3N3O2 — CID 2968088
5-phenyl-3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 2968088) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 5-phenyl-3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | 5-phenyl-3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2968088 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-phenyl-3-(pyridin-3-ylmethyl)-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(C(F)(F)F)C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C16H12F3N3O2/c17-16(18,19)15(12-6-2-1-3-7-12)13(23)22(14(24)21-15)10-11-5-4-8-20-9-11/h1-9H,10H2,(H,21,24) |
| InChIKey | WPSWMLZBXDOMJU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|