C12H19NO2 — CID 2970515
N-(3,3-dimethylbutan-2-yl)-2-methylfuran-3-carboxamide (PubChem CID 2970515) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 2970515 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C12H19NO2/c1-8-10(6-7-15-8)11(14)13-9(2)12(3,4)5/h6-7,9H,1-5H3,(H,13,14) |
| InChIKey | RGDQHHATFFDSSG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |