About 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride
2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride (PubChem CID 2971918) has the molecular formula C18H21ClN4O
and a molecular weight of 344.85 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride |
| PubChem CID | 2971918 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(NCCO)c3ccccc3n2)cc1C.Cl |
| InChI | InChI=1S/C18H20N4O.ClH/c1-12-7-8-14(11-13(12)2)20-18-21-16-6-4-3-5-15(16)17(22-18)19-9-10-23;/h3-8,11,23H,9-10H2,1-2H3,(H2,19,20,21,22);1H |
| InChIKey | ZGZOYCYIXXYYOB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride?
The IUPAC name of 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride (CID 2971918) is 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride.
What is the SMILES notation for 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride?
The canonical SMILES for 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride is Cc1ccc(Nc2nc(NCCO)c3ccccc3n2)cc1C.Cl.
What is the InChIKey of 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride?
The InChIKey is ZGZOYCYIXXYYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O.ClH/c1-12-7-8-14(11-13(12)2)20-18-21-16-6-4-3-5-15(16)17(22-18)19-9-10-23;/h3-8,11,23H,9-10H2,1-2H3,(H2,19,20,21,22);1H.
What are the key properties of 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride?
2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride has a molecular weight of 344.85 g/mol, XLogP of 3.82, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride is sourced from PubChem (CID 2971918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).