C18H21ClN4O — CID 2971918
2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride (PubChem CID 2971918) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride.
| Compound Name | 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 2971918 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[[2-(3,4-dimethylanilino)quinazolin-4-yl]amino]ethanol;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(NCCO)c3ccccc3n2)cc1C.Cl |
| InChI | InChI=1S/C18H20N4O.ClH/c1-12-7-8-14(11-13(12)2)20-18-21-16-6-4-3-5-15(16)17(22-18)19-9-10-23;/h3-8,11,23H,9-10H2,1-2H3,(H2,19,20,21,22);1H |
| InChIKey | ZGZOYCYIXXYYOB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |