C21H18N6O4S2 — CID 2972106
N-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 2972106) has the molecular formula C21H18N6O4S2 and a molecular weight of 482.55 g/mol. Its IUPAC name is N-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 2972106 |
| Molecular Formula | C21H18N6O4S2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc(NC(=O)Cn3cnc4ccccc4c3=O)s2)cc1 |
| InChI | InChI=1S/C21H18N6O4S2/c1-31-14-8-6-13(7-9-14)23-18(29)11-32-21-26-25-20(33-21)24-17(28)10-27-12-22-16-5-3-2-4-15(16)19(27)30/h2-9,12H,10-11H2,1H3,(H,23,29)(H,24,25,28) |
| InChIKey | DFFMJJUUCDGEKX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|