C21H18N6O3S2 — CID 2219291
3-[[5-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide (PubChem CID 2219291) has the molecular formula C21H18N6O3S2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 3-[[5-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide.
| Compound Name | 3-[[5-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 2219291 |
| Molecular Formula | C21H18N6O3S2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 3-[[5-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylpropanamide |
| SMILES | O=C(CCSc1nnc(NC(=O)Cn2cnc3ccccc3c2=O)s1)Nc1ccccc1 |
| InChI | InChI=1S/C21H18N6O3S2/c28-17(23-14-6-2-1-3-7-14)10-11-31-21-26-25-20(32-21)24-18(29)12-27-13-22-16-9-5-4-8-15(16)19(27)30/h1-9,13H,10-12H2,(H,23,28)(H,24,25,29) |
| InChIKey | QASFEGCDEMOYPD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|