C24H26N2O3S — CID 2973501
2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(2-phenylphenyl)propanamide (PubChem CID 2973501) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(2-phenylphenyl)propanamide.
| Compound Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 2973501 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(2-phenylphenyl)propanamide |
| SMILES | Cc1ccc(N(C(C)C(=O)Nc2ccccc2-c2ccccc2)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C24H26N2O3S/c1-17-14-15-21(16-18(17)2)26(30(4,28)29)19(3)24(27)25-23-13-9-8-12-22(23)20-10-6-5-7-11-20/h5-16,19H,1-4H3,(H,25,27) |
| InChIKey | CRTGMMJPADRYCL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |