C19H23IN2O3S — CID 2227673
(2R)-2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodo-2-methylphenyl)propanamide (PubChem CID 2227673) has the molecular formula C19H23IN2O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodo-2-methylphenyl)propanamide.
| Compound Name | (2R)-2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodo-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 2227673 |
| Molecular Formula | C19H23IN2O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | (2R)-2-(3,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodo-2-methylphenyl)propanamide |
| SMILES | Cc1ccc(N([C@H](C)C(=O)Nc2ccc(I)cc2C)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C19H23IN2O3S/c1-12-6-8-17(11-13(12)2)22(26(5,24)25)15(4)19(23)21-18-9-7-16(20)10-14(18)3/h6-11,15H,1-5H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | SSZHCFKLFIZIMV-OAHLLOKOSA-N |
| XLogP | 4.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|