C25H32N2O7 — CID 2975104
[4-[2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]piperazin-1-yl]-phenylmethanone;oxalic acid (PubChem CID 2975104) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is [4-[2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]piperazin-1-yl]-phenylmethanone;oxalic acid.
| Compound Name | [4-[2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]piperazin-1-yl]-phenylmethanone;oxalic acid |
|---|---|
| PubChem CID | 2975104 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | [4-[2-hydroxy-3-(2,4,6-trimethylphenoxy)propyl]piperazin-1-yl]-phenylmethanone;oxalic acid |
| SMILES | Cc1cc(C)c(OCC(O)CN2CCN(C(=O)c3ccccc3)CC2)c(C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30N2O3.C2H2O4/c1-17-13-18(2)22(19(3)14-17)28-16-21(26)15-24-9-11-25(12-10-24)23(27)20-7-5-4-6-8-20;3-1(4)2(5)6/h4-8,13-14,21,26H,9-12,15-16H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SFFHWWDYHNRLFY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|