C23H28N2O7 — CID 16801169
[4-(2-hydroxy-3-phenylmethoxypropyl)piperazin-1-yl]-phenylmethanone;oxalic acid (PubChem CID 16801169) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is [4-(2-hydroxy-3-phenylmethoxypropyl)piperazin-1-yl]-phenylmethanone;oxalic acid.
| Compound Name | [4-(2-hydroxy-3-phenylmethoxypropyl)piperazin-1-yl]-phenylmethanone;oxalic acid |
|---|---|
| PubChem CID | 16801169 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [4-(2-hydroxy-3-phenylmethoxypropyl)piperazin-1-yl]-phenylmethanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1ccccc1)N1CCN(CC(O)COCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O3.C2H2O4/c24-20(17-26-16-18-7-3-1-4-8-18)15-22-11-13-23(14-12-22)21(25)19-9-5-2-6-10-19;3-1(4)2(5)6/h1-10,20,24H,11-17H2;(H,3,4)(H,5,6) |
| InChIKey | RMNRGKOYRWNQJB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|