About phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone
phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone (PubChem CID 653321) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone.
Molecular Properties
| Compound Name | phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone |
| PubChem CID | 653321 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone |
| SMILES | O=C(c1ccccc1)N1CCCOC1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c19-16(14-8-3-1-4-9-14)18-12-7-13-20-17(18)15-10-5-2-6-11-15/h1-6,8-11,17H,7,12-13H2 |
| InChIKey | GHIKPWKHIXYSRF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone?
The IUPAC name of phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone (CID 653321) is phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone.
What is the SMILES notation for phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone?
The canonical SMILES for phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone is O=C(c1ccccc1)N1CCCOC1c1ccccc1.
What is the InChIKey of phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone?
The InChIKey is GHIKPWKHIXYSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO2/c19-16(14-8-3-1-4-9-14)18-12-7-13-20-17(18)15-10-5-2-6-11-15/h1-6,8-11,17H,7,12-13H2.
What are the key properties of phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone?
phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone has a molecular weight of 267.33 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(2-phenyl-1,3-oxazinan-3-yl)methanone is sourced from PubChem (CID 653321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).