C29H32N2O2 — CID 44529913
[4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-phenylmethanone (PubChem CID 44529913) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 44529913 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [4-[(2,2-diphenylmorpholin-4-yl)methyl]piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(CN2CCOC(c3ccccc3)(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C29H32N2O2/c32-28(25-10-4-1-5-11-25)31-18-16-24(17-19-31)22-30-20-21-33-29(23-30,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,24H,16-23H2 |
| InChIKey | ODJKJMZENGPOBZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |