C15H11Cl2NO3S — CID 2976345
4-chloro-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-7-methyl-1H-indol-2-one (PubChem CID 2976345) has the molecular formula C15H11Cl2NO3S and a molecular weight of 356.23 g/mol. Its IUPAC name is 4-chloro-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-7-methyl-1H-indol-2-one.
| Compound Name | 4-chloro-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-7-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 2976345 |
| Molecular Formula | C15H11Cl2NO3S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 4-chloro-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-7-methyl-1H-indol-2-one |
| SMILES | Cc1ccc(Cl)c2c1NC(=O)C2(O)CC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H11Cl2NO3S/c1-7-2-3-8(16)12-13(7)18-14(20)15(12,21)6-9(19)10-4-5-11(17)22-10/h2-5,21H,6H2,1H3,(H,18,20) |
| InChIKey | DNEJKGGGPJUUFM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |