C19H18N4O6S — CID 2976492
2-[[5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 2976492) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is 2-[[5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2976492 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-[[5-(2-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | CCOc1ccccc1-c1nnc(SCC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H18N4O6S/c1-3-28-16-7-5-4-6-13(16)18-21-22-19(29-18)30-11-17(24)20-14-9-8-12(27-2)10-15(14)23(25)26/h4-10H,3,11H2,1-2H3,(H,20,24) |
| InChIKey | HWDXJLYBWDVIKB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|