C19H16N4O6S — CID 3968403
ethyl 2-[[2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 3968403) has the molecular formula C19H16N4O6S and a molecular weight of 428.43 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 3968403 |
| Molecular Formula | C19H16N4O6S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | ethyl 2-[[2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CSc1nnc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H16N4O6S/c1-2-28-18(25)12-7-3-5-9-14(12)20-16(24)11-30-19-22-21-17(29-19)13-8-4-6-10-15(13)23(26)27/h3-10H,2,11H2,1H3,(H,20,24) |
| InChIKey | WVLXBILPCYEEFZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|