C22H23ClN6O4S — CID 4215185
N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4215185) has the molecular formula C22H23ClN6O4S and a molecular weight of 502.98 g/mol. Its IUPAC name is N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4215185 |
| Molecular Formula | C22H23ClN6O4S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCN1CCN(c2c(Cl)cccc2NC(=O)CSc2nnc(-c3ccccc3[N+](=O)[O-])o2)CC1 |
| InChI | InChI=1S/C22H23ClN6O4S/c1-2-27-10-12-28(13-11-27)20-16(23)7-5-8-17(20)24-19(30)14-34-22-26-25-21(33-22)15-6-3-4-9-18(15)29(31)32/h3-9H,2,10-14H2,1H3,(H,24,30) |
| InChIKey | WVXFHSZTAHFISU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|