C21H20ClN5O4S — CID 4695392
N-(3-chloro-2-piperidin-1-ylphenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4695392) has the molecular formula C21H20ClN5O4S and a molecular weight of 473.94 g/mol. Its IUPAC name is N-(3-chloro-2-piperidin-1-ylphenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chloro-2-piperidin-1-ylphenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4695392 |
| Molecular Formula | C21H20ClN5O4S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | N-(3-chloro-2-piperidin-1-ylphenyl)-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc([N+](=O)[O-])cc2)o1)Nc1cccc(Cl)c1N1CCCCC1 |
| InChI | InChI=1S/C21H20ClN5O4S/c22-16-5-4-6-17(19(16)26-11-2-1-3-12-26)23-18(28)13-32-21-25-24-20(31-21)14-7-9-15(10-8-14)27(29)30/h4-10H,1-3,11-13H2,(H,23,28) |
| InChIKey | NKULSUGCZRZRFS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|