C22H20F3N5O4S — CID 5164774
2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 5164774) has the molecular formula C22H20F3N5O4S and a molecular weight of 507.49 g/mol. Its IUPAC name is 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 5164774 |
| Molecular Formula | C22H20F3N5O4S |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc([N+](=O)[O-])cc2)o1)Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
| InChI | InChI=1S/C22H20F3N5O4S/c23-22(24,25)15-6-9-18(29-10-2-1-3-11-29)17(12-15)26-19(31)13-35-21-28-27-20(34-21)14-4-7-16(8-5-14)30(32)33/h4-9,12H,1-3,10-11,13H2,(H,26,31) |
| InChIKey | JIJISQDCPJLGRY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|