C21H18F3N5O4S — CID 3544086
2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 3544086) has the molecular formula C21H18F3N5O4S and a molecular weight of 493.47 g/mol. Its IUPAC name is 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3544086 |
| Molecular Formula | C21H18F3N5O4S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-[[5-(3-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1ccc(C(F)(F)F)cc1N1CCCC1 |
| InChI | InChI=1S/C21H18F3N5O4S/c22-21(23,24)14-6-7-16(17(11-14)28-8-1-2-9-28)25-18(30)12-34-20-27-26-19(33-20)13-4-3-5-15(10-13)29(31)32/h3-7,10-11H,1-2,8-9,12H2,(H,25,30) |
| InChIKey | ZROXNIKJUNFWTE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|