C23H22N2O6 — CID 2976690
ethyl 3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]benzoate (PubChem CID 2976690) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is ethyl 3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 2976690 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | ethyl 3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)c1 |
| InChI | InChI=1S/C23H22N2O6/c1-2-30-23(29)15-5-3-6-16(11-15)24-20(26)14-8-9-18-19(12-14)22(28)25(21(18)27)13-17-7-4-10-31-17/h3,5-6,8-9,11-12,17H,2,4,7,10,13H2,1H3,(H,24,26) |
| InChIKey | URKNIBFQRILCCH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|