C26H24N2O6 — CID 2977494
[4-[2-(5,6-dimethylbenzimidazol-1-yl)ethoxy]phenyl]-phenylmethanone;oxalic acid (PubChem CID 2977494) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is [4-[2-(5,6-dimethylbenzimidazol-1-yl)ethoxy]phenyl]-phenylmethanone;oxalic acid.
| Compound Name | [4-[2-(5,6-dimethylbenzimidazol-1-yl)ethoxy]phenyl]-phenylmethanone;oxalic acid |
|---|---|
| PubChem CID | 2977494 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [4-[2-(5,6-dimethylbenzimidazol-1-yl)ethoxy]phenyl]-phenylmethanone;oxalic acid |
| SMILES | Cc1cc2ncn(CCOc3ccc(C(=O)c4ccccc4)cc3)c2cc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H22N2O2.C2H2O4/c1-17-14-22-23(15-18(17)2)26(16-25-22)12-13-28-21-10-8-20(9-11-21)24(27)19-6-4-3-5-7-19;3-1(4)2(5)6/h3-11,14-16H,12-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DBWWECZUBKQRJC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|