C17H12N2O6 — CID 2978582
2-[5-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]furan-2-yl]benzoic acid (PubChem CID 2978582) has the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. Its IUPAC name is 2-[5-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 2978582 |
| Molecular Formula | C17H12N2O6 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[5-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]furan-2-yl]benzoic acid |
| SMILES | Cc1noc(C=Cc2ccc(-c3ccccc3C(=O)O)o2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N2O6/c1-10-16(19(22)23)15(25-18-10)9-7-11-6-8-14(24-11)12-4-2-3-5-13(12)17(20)21/h2-9H,1H3,(H,20,21) |
| InChIKey | SSCIWJQAQNZUJU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|