C13H10N2O5 — CID 5223947
2-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]benzoic acid (PubChem CID 5223947) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]benzoic acid.
| Compound Name | 2-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 5223947 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]benzoic acid |
| SMILES | Cc1noc(C=Cc2ccccc2C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10N2O5/c1-8-12(15(18)19)11(20-14-8)7-6-9-4-2-3-5-10(9)13(16)17/h2-7H,1H3,(H,16,17) |
| InChIKey | QMDAFPRUJJYDBM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|