C15H13N2O7- — CID 7247781
2-[2-methoxy-6-[(Z)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]phenoxy]acetate (PubChem CID 7247781) has the molecular formula C15H13N2O7- and a molecular weight of 333.28 g/mol. Its IUPAC name is 2-[2-methoxy-6-[(Z)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]phenoxy]acetate.
| Compound Name | 2-[2-methoxy-6-[(Z)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7247781 |
| Molecular Formula | C15H13N2O7- |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[2-methoxy-6-[(Z)-2-(3-methyl-4-nitro-1,2-oxazol-5-yl)ethenyl]phenoxy]acetate |
| SMILES | COc1cccc(/C=C\c2onc(C)c2[N+](=O)[O-])c1OCC(=O)[O-] |
| InChI | InChI=1S/C15H14N2O7/c1-9-14(17(20)21)11(24-16-9)7-6-10-4-3-5-12(22-2)15(10)23-8-13(18)19/h3-7H,8H2,1-2H3,(H,18,19)/p-1/b7-6- |
| InChIKey | NBBNPXWZSTZATL-SREVYHEPSA-M |
| XLogP | 1.20 |
| TPSA | 127.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|