C23H23FN4O3S — CID 2978660
4-fluoro-N-[2-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 2978660) has the molecular formula C23H23FN4O3S and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-fluoro-N-[2-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 2978660 |
| Molecular Formula | C23H23FN4O3S |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 4-fluoro-N-[2-[5-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(CCNC(=O)c2ccc(F)cc2)nnc1SCC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H23FN4O3S/c1-3-14-28-21(12-13-25-22(30)17-4-8-18(24)9-5-17)26-27-23(28)32-15-20(29)16-6-10-19(31-2)11-7-16/h3-11H,1,12-15H2,2H3,(H,25,30) |
| InChIKey | VLJXOIREGMLBPH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|