C23H25FN4O3S — CID 3454743
2-fluoro-N-[2-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 3454743) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-fluoro-N-[2-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 3454743 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-fluoro-N-[2-[5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(CCNC(=O)c2ccccc2F)nnc1SCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H25FN4O3S/c1-3-14-28-21(12-13-25-22(29)19-6-4-5-7-20(19)24)26-27-23(28)32-16-15-31-18-10-8-17(30-2)9-11-18/h3-11H,1,12-16H2,2H3,(H,25,29) |
| InChIKey | JWBOLHCWCGADLX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|