C22H25FN4O3S — CID 4020088
N-[2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide (PubChem CID 4020088) has the molecular formula C22H25FN4O3S and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4020088 |
| Molecular Formula | C22H25FN4O3S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-[2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
| SMILES | CCn1c(CCNC(=O)c2ccccc2F)nnc1SCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25FN4O3S/c1-3-27-20(12-13-24-21(28)18-6-4-5-7-19(18)23)25-26-22(27)31-15-14-30-17-10-8-16(29-2)9-11-17/h4-11H,3,12-15H2,1-2H3,(H,24,28) |
| InChIKey | CXYFHKOESWVQFQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|