C21H21N3O2S — CID 2979995
2-[4-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)phenoxy]-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 2979995) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-[4-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)phenoxy]-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[4-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)phenoxy]-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2979995 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-[4-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)phenoxy]-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccccc1NC(=O)COc1ccc(C=C(C#N)C(N)=S)cc1 |
| InChI | InChI=1S/C21H21N3O2S/c1-14(2)18-5-3-4-6-19(18)24-20(25)13-26-17-9-7-15(8-10-17)11-16(12-22)21(23)27/h3-11,14H,13H2,1-2H3,(H2,23,27)(H,24,25) |
| InChIKey | DKKXQVFQBJABPG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|